C36H44N2O10S — CID 78387788
bis(9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol);sulfuric acid (PubChem CID 78387788) has the molecular formula C36H44N2O10S and a molecular weight of 696.82 g/mol. Its IUPAC name is bis(9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol);sulfuric acid.
| Compound Name | bis(9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol);sulfuric acid |
|---|---|
| PubChem CID | 78387788 |
| Molecular Formula | C36H44N2O10S |
| Molecular Weight | 696.82 g/mol |
| Exact Mass | 696.27 |
| IUPAC Name | bis(9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol);sulfuric acid |
| SMILES | COc1ccc2c3c1OC1C(O)C=CC4C(C2)N(C)CCC341.COc1ccc2c3c1OC1C(O)C=CC4C(C2)N(C)CCC341.O=S(=O)(O)O |
| InChI | InChI=1S/2C18H21NO3.H2O4S/c2*1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19;1-5(2,3)4/h2*3-6,11-13,17,20H,7-9H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | BCXHDORHMMZBBZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.82 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|