C40H40N2O10S2 — CID 46235365
bis[(4R,4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] benzene-1,2-disulfonate (PubChem CID 46235365) has the molecular formula C40H40N2O10S2 and a molecular weight of 772.90 g/mol. Its IUPAC name is bis[(4R,4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] benzene-1,2-disulfonate.
| Compound Name | bis[(4R,4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] benzene-1,2-disulfonate |
|---|---|
| PubChem CID | 46235365 |
| Molecular Formula | C40H40N2O10S2 |
| Molecular Weight | 772.90 g/mol |
| Exact Mass | 772.21 |
| IUPAC Name | bis[(4R,4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] benzene-1,2-disulfonate |
| SMILES | CN1CC[C@]23c4c5ccc(OS(=O)(=O)c6ccccc6S(=O)(=O)Oc6ccc7c8c6O[C@H]6[C@@H](O)C=C[C@H]9[C@@H](C7)N(C)CC[C@@]896)c4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C40H40N2O10S2/c1-41-17-15-39-23-9-11-27(43)37(39)49-35-29(13-7-21(33(35)39)19-25(23)41)51-53(45,46)31-5-3-4-6-32(31)54(47,48)52-30-14-8-22-20-26-24-10-12-28(44)38-40(24,16-18-42(26)2)34(22)36(30)50-38/h3-14,23-28,37-38,43-44H,15-20H2,1-2H3/t23-,24-,25+,26+,27-,28-,37-,38-,39-,40-/m0/s1 |
| InChIKey | ATBZOIMOJJGFPP-DXXGPIMYSA-N |
| XLogP | 2.83 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.90 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|