C18H18F3NO5S — CID 89160402
[(4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] trifluoromethanesulfonate (PubChem CID 89160402) has the molecular formula C18H18F3NO5S and a molecular weight of 417.41 g/mol. Its IUPAC name is [(4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] trifluoromethanesulfonate.
| Compound Name | [(4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89160402 |
| Molecular Formula | C18H18F3NO5S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [(4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] trifluoromethanesulfonate |
| SMILES | CN1CC[C@]23c4c5ccc(OS(=O)(=O)C(F)(F)F)c4O[C@H]2[C@@H](O)C=C[C@H]3C1C5 |
| InChI | InChI=1S/C18H18F3NO5S/c1-22-7-6-17-10-3-4-12(23)16(17)26-15-13(27-28(24,25)18(19,20)21)5-2-9(14(15)17)8-11(10)22/h2-5,10-12,16,23H,6-8H2,1H3/t10-,11?,12-,16-,17-/m0/s1 |
| InChIKey | BDSVSSUCVRQXEW-TUMICRDWSA-N |
| XLogP | 1.72 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|