C38H44N2O4 — CID 123151271
17-(cyclopropylmethyl)-N-[2-[4-(4-formylphenyl)phenyl]ethyl]-3,13-dimethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide (PubChem CID 123151271) has the molecular formula C38H44N2O4 and a molecular weight of 592.78 g/mol. Its IUPAC name is 17-(cyclopropylmethyl)-N-[2-[4-(4-formylphenyl)phenyl]ethyl]-3,13-dimethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide.
| Compound Name | 17-(cyclopropylmethyl)-N-[2-[4-(4-formylphenyl)phenyl]ethyl]-3,13-dimethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 123151271 |
| Molecular Formula | C38H44N2O4 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | 17-(cyclopropylmethyl)-N-[2-[4-(4-formylphenyl)phenyl]ethyl]-3,13-dimethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide |
| SMILES | COc1c(C(=O)NCCc2ccc(-c3ccc(C=O)cc3)cc2)ccc2c1C13CCN(CC4CC4)C(C2)C1CCC(OC)C3 |
| InChI | InChI=1S/C38H44N2O4/c1-43-31-14-16-33-34-21-30-13-15-32(36(44-2)35(30)38(33,22-31)18-20-40(34)23-26-3-4-26)37(42)39-19-17-25-5-9-28(10-6-25)29-11-7-27(24-41)8-12-29/h5-13,15,24,26,31,33-34H,3-4,14,16-23H2,1-2H3,(H,39,42) |
| InChIKey | WIGIJQGOUMOMSM-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|