C21H26NO5+ — CID 58380428
(3R,4S,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9,11-trihydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one (PubChem CID 58380428) has the molecular formula C21H26NO5+ and a molecular weight of 372.44 g/mol. Its IUPAC name is (3R,4S,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9,11-trihydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one.
| Compound Name | (3R,4S,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9,11-trihydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
|---|---|
| PubChem CID | 58380428 |
| Molecular Formula | C21H26NO5+ |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (3R,4S,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9,11-trihydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
| SMILES | C[N@+]1(CC2CC2)CC[C@]23c4c5c(O)cc(O)c4O[C@H]2C(=O)CC[C@@]3(O)[C@@H]1C5 |
| InChI | InChI=1S/C21H25NO5/c1-22(10-11-2-3-11)7-6-20-17-12-8-16(22)21(20,26)5-4-13(23)19(20)27-18(17)15(25)9-14(12)24/h9,11,16,19,26H,2-8,10H2,1H3,(H-,24,25)/p+1/t16-,19-,20-,21+,22+/m0/s1 |
| InChIKey | VUZOTVZVHHTUDW-XXGVUKKKSA-O |
| XLogP | 1.38 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|