C22H28NO5+ — CID 58380468
(3R,4S,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-10-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one (PubChem CID 58380468) has the molecular formula C22H28NO5+ and a molecular weight of 386.47 g/mol. Its IUPAC name is (3R,4S,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-10-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one.
| Compound Name | (3R,4S,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-10-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
|---|---|
| PubChem CID | 58380468 |
| Molecular Formula | C22H28NO5+ |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (3R,4S,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-10-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
| SMILES | COc1cc2c3c(c1O)O[C@H]1C(=O)CC[C@@]4(O)[C@H](C2)[N@@+](C)(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C22H27NO5/c1-23(11-12-3-4-12)8-7-21-17-13-9-15(27-2)18(25)19(17)28-20(21)14(24)5-6-22(21,26)16(23)10-13/h9,12,16,20,26H,3-8,10-11H2,1-2H3/p+1/t16-,20-,21-,22+,23+/m0/s1 |
| InChIKey | BKXYIKDOSJZIRI-VXDOVQPVSA-O |
| XLogP | 1.68 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|