C21H26NO6+ — CID 58380412
(3S,4S,4aS,7aR,12bS)-3-[cyclopropyl(hydroxy)methyl]-4a,9,10-trihydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one (PubChem CID 58380412) has the molecular formula C21H26NO6+ and a molecular weight of 388.44 g/mol. Its IUPAC name is (3S,4S,4aS,7aR,12bS)-3-[cyclopropyl(hydroxy)methyl]-4a,9,10-trihydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one.
| Compound Name | (3S,4S,4aS,7aR,12bS)-3-[cyclopropyl(hydroxy)methyl]-4a,9,10-trihydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
|---|---|
| PubChem CID | 58380412 |
| Molecular Formula | C21H26NO6+ |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (3S,4S,4aS,7aR,12bS)-3-[cyclopropyl(hydroxy)methyl]-4a,9,10-trihydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
| SMILES | C[N@+]1(C(O)C2CC2)CC[C@]23c4c5cc(O)c(O)c4O[C@H]2C(=O)CC[C@@]3(O)[C@@H]1C5 |
| InChI | InChI=1S/C21H25NO6/c1-22(19(26)10-2-3-10)7-6-20-15-11-8-13(24)16(25)17(15)28-18(20)12(23)4-5-21(20,27)14(22)9-11/h8,10,14,18-19,26-27H,2-7,9H2,1H3,(H-,24,25)/p+1/t14-,18-,19?,20-,21+,22-/m0/s1 |
| InChIKey | JSZNGBFSNMBVPA-RWDBSITESA-O |
| XLogP | 0.69 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|