C19H28N2O2 — CID 142397456
3-[(4aS)-7a-hydroxy-1,2-dimethyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyridin-4a-yl]-4-ethylbenzamide (PubChem CID 142397456) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 3-[(4aS)-7a-hydroxy-1,2-dimethyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyridin-4a-yl]-4-ethylbenzamide.
| Compound Name | 3-[(4aS)-7a-hydroxy-1,2-dimethyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyridin-4a-yl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 142397456 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 3-[(4aS)-7a-hydroxy-1,2-dimethyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyridin-4a-yl]-4-ethylbenzamide |
| SMILES | CCc1ccc(C(N)=O)cc1[C@@]12CCCC1(O)C(C)N(C)CC2 |
| InChI | InChI=1S/C19H28N2O2/c1-4-14-6-7-15(17(20)22)12-16(14)18-8-5-9-19(18,23)13(2)21(3)11-10-18/h6-7,12-13,23H,4-5,8-11H2,1-3H3,(H2,20,22)/t13?,18-,19?/m0/s1 |
| InChIKey | PDMQRJCTERLNLG-SZSCYUJKSA-N |
| XLogP | 2.22 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |