C24H31N3O — CID 140778671
(9R,13R)-1,10-dimethyl-13-[methyl(2-phenylethyl)amino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide (PubChem CID 140778671) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is (9R,13R)-1,10-dimethyl-13-[methyl(2-phenylethyl)amino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide.
| Compound Name | (9R,13R)-1,10-dimethyl-13-[methyl(2-phenylethyl)amino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 140778671 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | (9R,13R)-1,10-dimethyl-13-[methyl(2-phenylethyl)amino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
| SMILES | CN1CCC2(C)c3cc(C(N)=O)ccc3C[C@@H]1[C@@H]2N(C)CCc1ccccc1 |
| InChI | InChI=1S/C24H31N3O/c1-24-12-14-26(2)21(16-18-9-10-19(23(25)28)15-20(18)24)22(24)27(3)13-11-17-7-5-4-6-8-17/h4-10,15,21-22H,11-14,16H2,1-3H3,(H2,25,28)/t21-,22+,24?/m1/s1 |
| InChIKey | RTJYCSXGPYLRLS-BVQDOMOSSA-N |
| XLogP | 2.85 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |