C25H34N2O3S — CID 126665194
(1S,9R,13R)-13-[ethyl-[2-(4-methylsulfonylphenyl)ethyl]amino]-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 126665194) has the molecular formula C25H34N2O3S and a molecular weight of 442.63 g/mol. Its IUPAC name is (1S,9R,13R)-13-[ethyl-[2-(4-methylsulfonylphenyl)ethyl]amino]-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1S,9R,13R)-13-[ethyl-[2-(4-methylsulfonylphenyl)ethyl]amino]-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 126665194 |
| Molecular Formula | C25H34N2O3S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (1S,9R,13R)-13-[ethyl-[2-(4-methylsulfonylphenyl)ethyl]amino]-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | CCN(CCc1ccc(S(C)(=O)=O)cc1)[C@H]1[C@H]2Cc3ccc(O)cc3[C@]1(C)CCN2C |
| InChI | InChI=1S/C25H34N2O3S/c1-5-27(14-12-18-6-10-21(11-7-18)31(4,29)30)24-23-16-19-8-9-20(28)17-22(19)25(24,2)13-15-26(23)3/h6-11,17,23-24,28H,5,12-16H2,1-4H3/t23-,24+,25+/m1/s1 |
| InChIKey | TYOMBMVEVZYFFN-DSITVLBTSA-N |
| XLogP | 3.25 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |