C17H22N2O — CID 91421945
N-[(1S,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-yl]formamide (PubChem CID 91421945) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is N-[(1S,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-yl]formamide.
| Compound Name | N-[(1S,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-yl]formamide |
|---|---|
| PubChem CID | 91421945 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N-[(1S,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-yl]formamide |
| SMILES | O=CNC1CC[C@H]2[C@H]3Cc4ccccc4[C@@]2(CCN3)C1 |
| InChI | InChI=1S/C17H22N2O/c20-11-19-13-5-6-15-16-9-12-3-1-2-4-14(12)17(15,10-13)7-8-18-16/h1-4,11,13,15-16,18H,5-10H2,(H,19,20)/t13?,15-,16+,17+/m0/s1 |
| InChIKey | SXANROAPCLADSR-ZKWWWUMQSA-N |
| XLogP | 1.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|