C17H24N2O — CID 90870697
(1S,9R,10R,13S)-13-(methylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-ol (PubChem CID 90870697) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (1S,9R,10R,13S)-13-(methylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-ol.
| Compound Name | (1S,9R,10R,13S)-13-(methylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-ol |
|---|---|
| PubChem CID | 90870697 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (1S,9R,10R,13S)-13-(methylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-ol |
| SMILES | CN[C@H]1CC[C@H]2[C@H]3Cc4c(O)cccc4[C@@]2(CCN3)C1 |
| InChI | InChI=1S/C17H24N2O/c1-18-11-5-6-14-15-9-12-13(3-2-4-16(12)20)17(14,10-11)7-8-19-15/h2-4,11,14-15,18-20H,5-10H2,1H3/t11-,14-,15+,17+/m0/s1 |
| InChIKey | IILBYCBZUHJWKP-ZYIUAKIQSA-N |
| XLogP | 1.94 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |