C16H18NO3S- — CID 174694724
(1S,9R,10R)-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-6-sulfinate (PubChem CID 174694724) has the molecular formula C16H18NO3S- and a molecular weight of 304.39 g/mol. Its IUPAC name is (1S,9R,10R)-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-6-sulfinate.
| Compound Name | (1S,9R,10R)-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-6-sulfinate |
|---|---|
| PubChem CID | 174694724 |
| Molecular Formula | C16H18NO3S- |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (1S,9R,10R)-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-6-sulfinate |
| SMILES | O=C1CC[C@H]2[C@H]3Cc4c(S(=O)[O-])cccc4[C@@]2(CCN3)C1 |
| InChI | InChI=1S/C16H19NO3S/c18-10-4-5-13-14-8-11-12(2-1-3-15(11)21(19)20)16(13,9-10)6-7-17-14/h1-3,13-14,17H,4-9H2,(H,19,20)/p-1/t13-,14+,16+/m0/s1 |
| InChIKey | BPKAQOMIHSHYPG-SQWLQELKSA-M |
| XLogP | 1.45 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|