C19H23NO4 — CID 174627057
(1S,9R,10R)-3,4-dimethoxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-6-carbaldehyde (PubChem CID 174627057) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (1S,9R,10R)-3,4-dimethoxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-6-carbaldehyde.
| Compound Name | (1S,9R,10R)-3,4-dimethoxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-6-carbaldehyde |
|---|---|
| PubChem CID | 174627057 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (1S,9R,10R)-3,4-dimethoxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-6-carbaldehyde |
| SMILES | COc1cc(C=O)c2c(c1OC)[C@]13CCN[C@H](C2)[C@@H]1CCC(=O)C3 |
| InChI | InChI=1S/C19H23NO4/c1-23-16-7-11(10-21)13-8-15-14-4-3-12(22)9-19(14,5-6-20-15)17(13)18(16)24-2/h7,10,14-15,20H,3-6,8-9H2,1-2H3/t14-,15+,19-/m0/s1 |
| InChIKey | RROHTCCXSLTDBH-KHYOSLBOSA-N |
| XLogP | 2.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|