C23H24N2O2 — CID 90769482
N-[(1S,9R,10R)-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-yl]benzamide (PubChem CID 90769482) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[(1S,9R,10R)-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-yl]benzamide.
| Compound Name | N-[(1S,9R,10R)-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-yl]benzamide |
|---|---|
| PubChem CID | 90769482 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-[(1S,9R,10R)-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-yl]benzamide |
| SMILES | O=C1CC[C@H]2[C@H]3Cc4cccc(NC(=O)c5ccccc5)c4[C@@]2(CCN3)C1 |
| InChI | InChI=1S/C23H24N2O2/c26-17-9-10-18-20-13-16-7-4-8-19(21(16)23(18,14-17)11-12-24-20)25-22(27)15-5-2-1-3-6-15/h1-8,18,20,24H,9-14H2,(H,25,27)/t18-,20+,23-/m0/s1 |
| InChIKey | APVYDQUXTKDJRW-NOXFTYBFSA-N |
| XLogP | 3.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |