C21H25N3O2 — CID 120624536
(2S,4S)-N-(3-benzamido-2-methylphenyl)-2-methylpiperidine-4-carboxamide (PubChem CID 120624536) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2S,4S)-N-(3-benzamido-2-methylphenyl)-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-(3-benzamido-2-methylphenyl)-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120624536 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (2S,4S)-N-(3-benzamido-2-methylphenyl)-2-methylpiperidine-4-carboxamide |
| SMILES | Cc1c(NC(=O)c2ccccc2)cccc1NC(=O)[C@H]1CCN[C@@H](C)C1 |
| InChI | InChI=1S/C21H25N3O2/c1-14-13-17(11-12-22-14)21(26)24-19-10-6-9-18(15(19)2)23-20(25)16-7-4-3-5-8-16/h3-10,14,17,22H,11-13H2,1-2H3,(H,23,25)(H,24,26)/t14-,17-/m0/s1 |
| InChIKey | PBVHROFYYJDBGX-YOEHRIQHSA-N |
| XLogP | 3.57 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |