C20H24N2O — CID 120616695
(2S,4S)-N-(2-benzylphenyl)-2-methylpiperidine-4-carboxamide (PubChem CID 120616695) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is (2S,4S)-N-(2-benzylphenyl)-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-(2-benzylphenyl)-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120616695 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (2S,4S)-N-(2-benzylphenyl)-2-methylpiperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)Nc2ccccc2Cc2ccccc2)CCN1 |
| InChI | InChI=1S/C20H24N2O/c1-15-13-18(11-12-21-15)20(23)22-19-10-6-5-9-17(19)14-16-7-3-2-4-8-16/h2-10,15,18,21H,11-14H2,1H3,(H,22,23)/t15-,18-/m0/s1 |
| InChIKey | PGLXZEBPFAMQKM-YJBOKZPZSA-N |
| XLogP | 3.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |