C16H19NO2 — CID 129386680
(4R,4aR,7R,7aR,12bS)-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol (PubChem CID 129386680) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (4R,4aR,7R,7aR,12bS)-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol.
| Compound Name | (4R,4aR,7R,7aR,12bS)-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
|---|---|
| PubChem CID | 129386680 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (4R,4aR,7R,7aR,12bS)-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
| SMILES | O[C@@H]1CC[C@H]2[C@H]3Cc4cccc5c4[C@@]2(CCN3)[C@H]1O5 |
| InChI | InChI=1S/C16H19NO2/c18-12-5-4-10-11-8-9-2-1-3-13-14(9)16(10,6-7-17-11)15(12)19-13/h1-3,10-12,15,17-18H,4-8H2/t10-,11+,12+,15-,16-/m0/s1 |
| InChIKey | NTUQLFBJRFRUIN-GNZOJXKOSA-N |
| XLogP | 1.37 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |