C16H21NO2 — CID 141386502
(1S,9R,10R,13R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-6,13-diol (PubChem CID 141386502) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (1S,9R,10R,13R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-6,13-diol.
| Compound Name | (1S,9R,10R,13R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-6,13-diol |
|---|---|
| PubChem CID | 141386502 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (1S,9R,10R,13R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-6,13-diol |
| SMILES | Oc1cccc2c1C[C@H]1NCC[C@@]23C[C@H](O)CC[C@@H]13 |
| InChI | InChI=1S/C16H21NO2/c18-10-4-5-13-14-8-11-12(2-1-3-15(11)19)16(13,9-10)6-7-17-14/h1-3,10,13-14,17-19H,4-9H2/t10-,13+,14-,16-/m1/s1 |
| InChIKey | LVNVAHQKJWHAIN-FDKDBAQKSA-N |
| XLogP | 1.71 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |