C17H23NO3S — CID 141461183
[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-6-yl]methanesulfonic acid (PubChem CID 141461183) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is [(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-6-yl]methanesulfonic acid.
| Compound Name | [(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-6-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 141461183 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | [(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-6-yl]methanesulfonic acid |
| SMILES | O=S(=O)(O)Cc1cccc2c1C[C@H]1NCC[C@@]23CCCC[C@@H]13 |
| InChI | InChI=1S/C17H23NO3S/c19-22(20,21)11-12-4-3-6-14-13(12)10-16-15-5-1-2-7-17(14,15)8-9-18-16/h3-4,6,15-16,18H,1-2,5,7-11H2,(H,19,20,21)/t15-,16+,17-/m0/s1 |
| InChIKey | RAFKEGLXVFRDDU-BBWFWOEESA-N |
| XLogP | 2.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|