C22H34ClNO — CID 141144811
5-[(1R,9R,10R)-6-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-5-yl]pentan-1-ol;hydrochloride (PubChem CID 141144811) has the molecular formula C22H34ClNO and a molecular weight of 363.97 g/mol. Its IUPAC name is 5-[(1R,9R,10R)-6-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-5-yl]pentan-1-ol;hydrochloride.
| Compound Name | 5-[(1R,9R,10R)-6-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-5-yl]pentan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 141144811 |
| Molecular Formula | C22H34ClNO |
| Molecular Weight | 363.97 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 5-[(1R,9R,10R)-6-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-5-yl]pentan-1-ol;hydrochloride |
| SMILES | Cc1c(CCCCCO)ccc2c1C[C@H]1NCC[C@@]23CCCC[C@@H]13.Cl |
| InChI | InChI=1S/C22H33NO.ClH/c1-16-17(7-3-2-6-14-24)9-10-19-18(16)15-21-20-8-4-5-11-22(19,20)12-13-23-21;/h9-10,20-21,23-24H,2-8,11-15H2,1H3;1H/t20-,21+,22-;/m0./s1 |
| InChIKey | VFERSHVXNVKXDV-JDCPXUKWSA-N |
| XLogP | 4.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.97 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|