C18H22F3NO — CID 155059231
(1S,9S,10S)-6-methyl-4-(trifluoromethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 155059231) has the molecular formula C18H22F3NO and a molecular weight of 325.37 g/mol. Its IUPAC name is (1S,9S,10S)-6-methyl-4-(trifluoromethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1S,9S,10S)-6-methyl-4-(trifluoromethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 155059231 |
| Molecular Formula | C18H22F3NO |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (1S,9S,10S)-6-methyl-4-(trifluoromethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | Cc1cc(OC(F)(F)F)cc2c1C[C@@H]1NCC[C@]23CCCC[C@H]13 |
| InChI | InChI=1S/C18H22F3NO/c1-11-8-12(23-18(19,20)21)9-15-13(11)10-16-14-4-2-3-5-17(14,15)6-7-22-16/h8-9,14,16,22H,2-7,10H2,1H3/t14-,16+,17+/m1/s1 |
| InChIKey | PWXMDKRYCQAYEV-PVAVHDDUSA-N |
| XLogP | 4.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |