C21H29NO4 — CID 89422521
[1-[[(1R,9R,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-methylpropyl] hydrogen carbonate (PubChem CID 89422521) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is [1-[[(1R,9R,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-methylpropyl] hydrogen carbonate.
| Compound Name | [1-[[(1R,9R,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-methylpropyl] hydrogen carbonate |
|---|---|
| PubChem CID | 89422521 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | [1-[[(1R,9R,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-methylpropyl] hydrogen carbonate |
| SMILES | CC(C)C(OC(=O)O)Oc1ccc2c(c1)[C@@]13CCCC[C@@H]1[C@@H](C2)NCC3 |
| InChI | InChI=1S/C21H29NO4/c1-13(2)19(26-20(23)24)25-15-7-6-14-11-18-16-5-3-4-8-21(16,9-10-22-18)17(14)12-15/h6-7,12-13,16,18-19,22H,3-5,8-11H2,1-2H3,(H,23,24)/t16-,18-,19?,21-/m1/s1 |
| InChIKey | LOCQBHGUJYPVKP-RECOEVNISA-N |
| XLogP | 4.09 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|