C27H32N2O — CID 90911678
N-[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-yl]-N-methyl-3-(3-methylphenyl)prop-2-enamide (PubChem CID 90911678) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is N-[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-yl]-N-methyl-3-(3-methylphenyl)prop-2-enamide.
| Compound Name | N-[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-yl]-N-methyl-3-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90911678 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | N-[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-yl]-N-methyl-3-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(C=CC(=O)N(C)c2cccc3c2C[C@H]2NCC[C@@]34CCCC[C@@H]24)c1 |
| InChI | InChI=1S/C27H32N2O/c1-19-7-5-8-20(17-19)12-13-26(30)29(2)25-11-6-10-22-21(25)18-24-23-9-3-4-14-27(22,23)15-16-28-24/h5-8,10-13,17,23-24,28H,3-4,9,14-16,18H2,1-2H3/t23-,24+,27-/m0/s1 |
| InChIKey | WSELUHNAJSLVOV-XFAFFCHDSA-N |
| XLogP | 5.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|