C27H32N2O4 — CID 154200812
N-[(1S,9R,10R,13S)-5,6-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-yl]-3-(4-methoxyphenyl)-N-methylprop-2-enamide (PubChem CID 154200812) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is N-[(1S,9R,10R,13S)-5,6-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-yl]-3-(4-methoxyphenyl)-N-methylprop-2-enamide.
| Compound Name | N-[(1S,9R,10R,13S)-5,6-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-yl]-3-(4-methoxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 154200812 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | N-[(1S,9R,10R,13S)-5,6-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-yl]-3-(4-methoxyphenyl)-N-methylprop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)N(C)[C@H]2CC[C@H]3[C@H]4Cc5c(ccc(O)c5O)[C@@]3(CCN4)C2)cc1 |
| InChI | InChI=1S/C27H32N2O4/c1-29(25(31)12-5-17-3-7-19(33-2)8-4-17)18-6-9-22-23-15-20-21(10-11-24(30)26(20)32)27(22,16-18)13-14-28-23/h3-5,7-8,10-12,18,22-23,28,30,32H,6,9,13-16H2,1-2H3/t18-,22-,23+,27+/m0/s1 |
| InChIKey | CQUWSAMZZXOYRN-PQRZKXTNSA-N |
| XLogP | 3.60 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|