C24H26INO3 — CID 123916050
benzyl (1R,9R,10R)-4-hydroxy-5-iodo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-6-carboxylate (PubChem CID 123916050) has the molecular formula C24H26INO3 and a molecular weight of 503.38 g/mol. Its IUPAC name is benzyl (1R,9R,10R)-4-hydroxy-5-iodo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-6-carboxylate.
| Compound Name | benzyl (1R,9R,10R)-4-hydroxy-5-iodo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-6-carboxylate |
|---|---|
| PubChem CID | 123916050 |
| Molecular Formula | C24H26INO3 |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | benzyl (1R,9R,10R)-4-hydroxy-5-iodo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-6-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1c(I)c(O)cc2c1C[C@H]1NCC[C@@]23CCCC[C@@H]13 |
| InChI | InChI=1S/C24H26INO3/c25-22-20(27)13-18-16(21(22)23(28)29-14-15-6-2-1-3-7-15)12-19-17-8-4-5-9-24(17,18)10-11-26-19/h1-3,6-7,13,17,19,26-27H,4-5,8-12,14H2/t17-,19+,24+/m0/s1 |
| InChIKey | YWNKCNGUIUPODD-RGZWJVDOSA-N |
| XLogP | 4.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|