C20H30N4O2 — CID 139904527
N-amino-N'-[3-[(1S,9R,10R)-4,13-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-6-yl]propyl]methanimidamide (PubChem CID 139904527) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-amino-N'-[3-[(1S,9R,10R)-4,13-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-6-yl]propyl]methanimidamide.
| Compound Name | N-amino-N'-[3-[(1S,9R,10R)-4,13-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-6-yl]propyl]methanimidamide |
|---|---|
| PubChem CID | 139904527 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-amino-N'-[3-[(1S,9R,10R)-4,13-dihydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-6-yl]propyl]methanimidamide |
| SMILES | NN/C=N/CCCc1cc(O)cc2c1C[C@H]1NCC[C@@]23CC(O)CC[C@@H]13 |
| InChI | InChI=1S/C20H30N4O2/c21-24-12-22-6-1-2-13-8-15(26)9-18-16(13)10-19-17-4-3-14(25)11-20(17,18)5-7-23-19/h8-9,12,14,17,19,23,25-26H,1-7,10-11,21H2,(H,22,24)/t14?,17-,19+,20-/m0/s1 |
| InChIKey | OYLAFHITWYKQFA-ZDOSKEGBSA-N |
| XLogP | 1.13 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|