C17H21NO2 — CID 154353753
(1S,9R,10R,13R)-6-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4,13-diol (PubChem CID 154353753) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (1S,9R,10R,13R)-6-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4,13-diol.
| Compound Name | (1S,9R,10R,13R)-6-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4,13-diol |
|---|---|
| PubChem CID | 154353753 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (1S,9R,10R,13R)-6-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraene-4,13-diol |
| SMILES | Cc1cc(O)cc2c1C[C@H]1NCC[C@@]23C[C@@H](O)C=C[C@@H]13 |
| InChI | InChI=1S/C17H21NO2/c1-10-6-12(20)7-15-13(10)8-16-14-3-2-11(19)9-17(14,15)4-5-18-16/h2-3,6-7,11,14,16,18-20H,4-5,8-9H2,1H3/t11-,14-,16+,17-/m0/s1 |
| InChIKey | LTUAKPNHIOXWID-WPUCRFQZSA-N |
| XLogP | 1.79 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|