C18H21NO3 — CID 90421820
(1S,10R,11R,14R)-4-methoxy-18-methyl-6-oxa-18-azapentacyclo[8.5.3.01,11.02,8.05,7]octadeca-2,4,7,12-tetraen-14-ol (PubChem CID 90421820) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (1S,10R,11R,14R)-4-methoxy-18-methyl-6-oxa-18-azapentacyclo[8.5.3.01,11.02,8.05,7]octadeca-2,4,7,12-tetraen-14-ol.
| Compound Name | (1S,10R,11R,14R)-4-methoxy-18-methyl-6-oxa-18-azapentacyclo[8.5.3.01,11.02,8.05,7]octadeca-2,4,7,12-tetraen-14-ol |
|---|---|
| PubChem CID | 90421820 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (1S,10R,11R,14R)-4-methoxy-18-methyl-6-oxa-18-azapentacyclo[8.5.3.01,11.02,8.05,7]octadeca-2,4,7,12-tetraen-14-ol |
| SMILES | COc1cc2c(c3c1O3)C[C@@H]1[C@@H]3C=C[C@H](O)C[C@]23CCN1C |
| InChI | InChI=1S/C18H21NO3/c1-19-6-5-18-9-10(20)3-4-12(18)14(19)7-11-13(18)8-15(21-2)17-16(11)22-17/h3-4,8,10,12,14,20H,5-7,9H2,1-2H3/t10-,12-,14+,18-/m0/s1 |
| InChIKey | WBOZFHKYSMWVDM-XFFUPTALSA-N |
| XLogP | 2.24 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|