C19H23NO2 — CID 135143805
(1R,5R,13R,14S)-10-methoxy-4-methyl-4-azapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-ol (PubChem CID 135143805) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (1R,5R,13R,14S)-10-methoxy-4-methyl-4-azapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-ol.
| Compound Name | (1R,5R,13R,14S)-10-methoxy-4-methyl-4-azapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-ol |
|---|---|
| PubChem CID | 135143805 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (1R,5R,13R,14S)-10-methoxy-4-methyl-4-azapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-ol |
| SMILES | COc1ccc2c3c1C[C@H]1[C@@H](O)C=CC4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C19H23NO2/c1-20-8-7-19-13-4-5-16(21)14(19)10-12-17(22-2)6-3-11(18(12)19)9-15(13)20/h3-6,13-16,21H,7-10H2,1-2H3/t13?,14-,15+,16-,19+/m0/s1 |
| InChIKey | RHANVPUOUSWFFF-XIVKSUKPSA-N |
| XLogP | 1.91 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|