C10H11NO — CID 91019399
1,3,3a,4-tetrahydro-[1,3]oxazolo[3,4-a]indole (PubChem CID 91019399) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 1,3,3a,4-tetrahydro-[1,3]oxazolo[3,4-a]indole.
| Compound Name | 1,3,3a,4-tetrahydro-[1,3]oxazolo[3,4-a]indole |
|---|---|
| PubChem CID | 91019399 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 1,3,3a,4-tetrahydro-[1,3]oxazolo[3,4-a]indole |
| SMILES | c1ccc2c(c1)CC1COCN21 |
| InChI | InChI=1S/C10H11NO/c1-2-4-10-8(3-1)5-9-6-12-7-11(9)10/h1-4,9H,5-7H2 |
| InChIKey | FNBKMVRFBQGVEH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |