C12H15FN2 — CID 142337194
(10bS)-8-fluoro-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-1-amine (PubChem CID 142337194) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is (10bS)-8-fluoro-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-1-amine.
| Compound Name | (10bS)-8-fluoro-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-1-amine |
|---|---|
| PubChem CID | 142337194 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | (10bS)-8-fluoro-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-1-amine |
| SMILES | NC1CCN2CCc3cc(F)ccc3[C@@H]12 |
| InChI | InChI=1S/C12H15FN2/c13-9-1-2-10-8(7-9)3-5-15-6-4-11(14)12(10)15/h1-2,7,11-12H,3-6,14H2/t11?,12-/m0/s1 |
| InChIKey | YCNVMDFWNGYAQK-KIYNQFGBSA-N |
| XLogP | 1.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |