C10H11FO2 — CID 62737680
7-fluoro-1,2,4,5-tetrahydro-3-benzoxepin-5-ol (PubChem CID 62737680) has the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. Its IUPAC name is 7-fluoro-1,2,4,5-tetrahydro-3-benzoxepin-5-ol.
| Compound Name | 7-fluoro-1,2,4,5-tetrahydro-3-benzoxepin-5-ol |
|---|---|
| PubChem CID | 62737680 |
| Molecular Formula | C10H11FO2 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 7-fluoro-1,2,4,5-tetrahydro-3-benzoxepin-5-ol |
| SMILES | OC1COCCc2ccc(F)cc21 |
| InChI | InChI=1S/C10H11FO2/c11-8-2-1-7-3-4-13-6-10(12)9(7)5-8/h1-2,5,10,12H,3-4,6H2 |
| InChIKey | KNGCAECTRCZZQA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |