C10H9FO — CID 98080512
(1aS,7bS)-6-fluoro-1a,2,3,7b-tetrahydronaphtho[1,2-b]oxirene (PubChem CID 98080512) has the molecular formula C10H9FO and a molecular weight of 164.18 g/mol. Its IUPAC name is (1aS,7bS)-6-fluoro-1a,2,3,7b-tetrahydronaphtho[1,2-b]oxirene.
| Compound Name | (1aS,7bS)-6-fluoro-1a,2,3,7b-tetrahydronaphtho[1,2-b]oxirene |
|---|---|
| PubChem CID | 98080512 |
| Molecular Formula | C10H9FO |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | (1aS,7bS)-6-fluoro-1a,2,3,7b-tetrahydronaphtho[1,2-b]oxirene |
| SMILES | Fc1ccc2c(c1)[C@@H]1O[C@H]1CC2 |
| InChI | InChI=1S/C10H9FO/c11-7-3-1-6-2-4-9-10(12-9)8(6)5-7/h1,3,5,9-10H,2,4H2/t9-,10-/m0/s1 |
| InChIKey | PKNYNYAUDVVLDL-UWVGGRQHSA-N |
| XLogP | 2.21 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|