C17H15FO — CID 142248840
(2R,6S)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaene (PubChem CID 142248840) has the molecular formula C17H15FO and a molecular weight of 254.30 g/mol. Its IUPAC name is (2R,6S)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaene.
| Compound Name | (2R,6S)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaene |
|---|---|
| PubChem CID | 142248840 |
| Molecular Formula | C17H15FO |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (2R,6S)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaene |
| SMILES | Fc1ccc2c(c1)[C@@H]1OCC[C@H]1c1ccccc1C2 |
| InChI | InChI=1S/C17H15FO/c18-13-6-5-12-9-11-3-1-2-4-14(11)15-7-8-19-17(15)16(12)10-13/h1-6,10,15,17H,7-9H2/t15-,17+/m0/s1 |
| InChIKey | SSBZERLNCHFUAY-DOTOQJQBSA-N |
| XLogP | 3.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |