C20H24FNO — CID 143335819
18-fluoro-3-oxatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene;N-methylmethanamine (PubChem CID 143335819) has the molecular formula C20H24FNO and a molecular weight of 313.42 g/mol. Its IUPAC name is 18-fluoro-3-oxatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene;N-methylmethanamine.
| Compound Name | 18-fluoro-3-oxatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene;N-methylmethanamine |
|---|---|
| PubChem CID | 143335819 |
| Molecular Formula | C20H24FNO |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 18-fluoro-3-oxatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene;N-methylmethanamine |
| SMILES | CNC.Fc1ccc2c(c1)C1OCCCC1c1ccccc1C2 |
| InChI | InChI=1S/C18H17FO.C2H7N/c19-14-8-7-13-10-12-4-1-2-5-15(12)16-6-3-9-20-18(16)17(13)11-14;1-3-2/h1-2,4-5,7-8,11,16,18H,3,6,9-10H2;3H,1-2H3 |
| InChIKey | KMOXNGAYEVURTN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |