C23H25FO3 — CID 11222408
(2S,7R)-18-fluoro-5-(oxan-2-yloxy)-3-oxatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene (PubChem CID 11222408) has the molecular formula C23H25FO3 and a molecular weight of 368.45 g/mol. Its IUPAC name is (2S,7R)-18-fluoro-5-(oxan-2-yloxy)-3-oxatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene.
| Compound Name | (2S,7R)-18-fluoro-5-(oxan-2-yloxy)-3-oxatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene |
|---|---|
| PubChem CID | 11222408 |
| Molecular Formula | C23H25FO3 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (2S,7R)-18-fluoro-5-(oxan-2-yloxy)-3-oxatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene |
| SMILES | Fc1ccc2c(c1)[C@H]1OCC(OC3CCCCO3)C[C@@H]1c1ccccc1C2 |
| InChI | InChI=1S/C23H25FO3/c24-17-9-8-16-11-15-5-1-2-6-19(15)21-13-18(14-26-23(21)20(16)12-17)27-22-7-3-4-10-25-22/h1-2,5-6,8-9,12,18,21-23H,3-4,7,10-11,13-14H2/t18?,21-,22?,23-/m1/s1 |
| InChIKey | VCEDRNCMDUKWBM-SSXYFDDISA-N |
| XLogP | 4.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |