About (4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol
(4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol (PubChem CID 82886779) has the molecular formula C9H9FOS
and a molecular weight of 184.23 g/mol. Its IUPAC name is (4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol.
Molecular Properties
| Compound Name | (4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol |
| PubChem CID | 82886779 |
| Molecular Formula | C9H9FOS |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | (4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol |
| SMILES | O[C@H]1CSCc2ccc(F)cc21 |
| InChI | InChI=1S/C9H9FOS/c10-7-2-1-6-4-12-5-9(11)8(6)3-7/h1-3,9,11H,4-5H2/t9-/m0/s1 |
| InChIKey | DGOAVPVTEVSYOS-VIFPVBQESA-N |
| XLogP | 2.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol?
The IUPAC name of (4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol (CID 82886779) is (4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol.
What is the SMILES notation for (4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol?
The canonical SMILES for (4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol is O[C@H]1CSCc2ccc(F)cc21.
What is the InChIKey of (4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol?
The InChIKey is DGOAVPVTEVSYOS-VIFPVBQESA-N. The full InChI is InChI=1S/C9H9FOS/c10-7-2-1-6-4-12-5-9(11)8(6)3-7/h1-3,9,11H,4-5H2/t9-/m0/s1.
What are the key properties of (4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol?
(4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol has a molecular weight of 184.23 g/mol, XLogP of 2.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-6-fluoro-3,4-dihydro-1H-isothiochromen-4-ol is sourced from PubChem (CID 82886779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).