C15H14OS — CID 82885860
6-phenyl-3,4-dihydro-1H-isothiochromen-4-ol (PubChem CID 82885860) has the molecular formula C15H14OS and a molecular weight of 242.34 g/mol. Its IUPAC name is 6-phenyl-3,4-dihydro-1H-isothiochromen-4-ol.
| Compound Name | 6-phenyl-3,4-dihydro-1H-isothiochromen-4-ol |
|---|---|
| PubChem CID | 82885860 |
| Molecular Formula | C15H14OS |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 6-phenyl-3,4-dihydro-1H-isothiochromen-4-ol |
| SMILES | OC1CSCc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C15H14OS/c16-15-10-17-9-13-7-6-12(8-14(13)15)11-4-2-1-3-5-11/h1-8,15-16H,9-10H2 |
| InChIKey | PTZZZLYBWHWTKX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |