C11H14FNS — CID 105356574
3-ethyl-6-fluoro-3,4-dihydro-1H-isothiochromen-4-amine (PubChem CID 105356574) has the molecular formula C11H14FNS and a molecular weight of 211.30 g/mol. Its IUPAC name is 3-ethyl-6-fluoro-3,4-dihydro-1H-isothiochromen-4-amine.
| Compound Name | 3-ethyl-6-fluoro-3,4-dihydro-1H-isothiochromen-4-amine |
|---|---|
| PubChem CID | 105356574 |
| Molecular Formula | C11H14FNS |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3-ethyl-6-fluoro-3,4-dihydro-1H-isothiochromen-4-amine |
| SMILES | CCC1SCc2ccc(F)cc2C1N |
| InChI | InChI=1S/C11H14FNS/c1-2-10-11(13)9-5-8(12)4-3-7(9)6-14-10/h3-5,10-11H,2,6,13H2,1H3 |
| InChIKey | ZPWJHLOLGNFODS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |