About methyl 2-(2-amino-7-hydroxy-2,3-dihydro-1H-inden-1-yl)acetate
methyl 2-(2-amino-7-hydroxy-2,3-dihydro-1H-inden-1-yl)acetate (PubChem CID 166125955) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is methyl 2-(2-amino-7-hydroxy-2,3-dihydro-1H-inden-1-yl)acetate.
Analyze methyl 2-(2-amino-7-hydroxy-2,3-dihydro-1H-inden-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-amino-7-hydroxy-2,3-dihydro-1H-inden-1-yl)acetate?
The IUPAC name of methyl 2-(2-amino-7-hydroxy-2,3-dihydro-1H-inden-1-yl)acetate (CID 166125955) is methyl 2-(2-amino-7-hydroxy-2,3-dihydro-1H-inden-1-yl)acetate.
What is the SMILES notation for methyl 2-(2-amino-7-hydroxy-2,3-dihydro-1H-inden-1-yl)acetate?
The canonical SMILES for methyl 2-(2-amino-7-hydroxy-2,3-dihydro-1H-inden-1-yl)acetate is COC(=O)CC1c2c(O)cccc2CC1N.
What is the InChIKey of methyl 2-(2-amino-7-hydroxy-2,3-dihydro-1H-inden-1-yl)acetate?
The InChIKey is RDNSDARRXDNJJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c1-16-11(15)6-8-9(13)5-7-3-2-4-10(14)12(7)8/h2-4,8-9,14H,5-6,13H2,1H3.
What are the key properties of methyl 2-(2-amino-7-hydroxy-2,3-dihydro-1H-inden-1-yl)acetate?
methyl 2-(2-amino-7-hydroxy-2,3-dihydro-1H-inden-1-yl)acetate has a molecular weight of 221.26 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-amino-7-hydroxy-2,3-dihydro-1H-inden-1-yl)acetate is sourced from PubChem (CID 166125955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).