About methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate
methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate (PubChem CID 166125910) has the molecular formula C15H21NO4
and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate.
Molecular Properties
| Compound Name | methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate |
| PubChem CID | 166125910 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate |
| SMILES | COC(=O)CCCOC1c2c(cccc2OC)CC1N |
| InChI | InChI=1S/C15H21NO4/c1-18-12-6-3-5-10-9-11(16)15(14(10)12)20-8-4-7-13(17)19-2/h3,5-6,11,15H,4,7-9,16H2,1-2H3 |
| InChIKey | ZRVDENGSHCPOJE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate?
The IUPAC name of methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate (CID 166125910) is methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate.
What is the SMILES notation for methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate?
The canonical SMILES for methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate is COC(=O)CCCOC1c2c(cccc2OC)CC1N.
What is the InChIKey of methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate?
The InChIKey is ZRVDENGSHCPOJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4/c1-18-12-6-3-5-10-9-11(16)15(14(10)12)20-8-4-7-13(17)19-2/h3,5-6,11,15H,4,7-9,16H2,1-2H3.
What are the key properties of methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate?
methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate has a molecular weight of 279.34 g/mol, XLogP of 1.59, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2-amino-7-methoxy-2,3-dihydro-1H-inden-1-yl)oxy]butanoate is sourced from PubChem (CID 166125910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).