C15H23NO4 — CID 167179258
4-[(2-amino-7-ethoxy-2,3-dihydro-1H-inden-1-yl)oxy]butane-1,1-diol (PubChem CID 167179258) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 4-[(2-amino-7-ethoxy-2,3-dihydro-1H-inden-1-yl)oxy]butane-1,1-diol.
| Compound Name | 4-[(2-amino-7-ethoxy-2,3-dihydro-1H-inden-1-yl)oxy]butane-1,1-diol |
|---|---|
| PubChem CID | 167179258 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4-[(2-amino-7-ethoxy-2,3-dihydro-1H-inden-1-yl)oxy]butane-1,1-diol |
| SMILES | CCOc1cccc2c1C(OCCCC(O)O)C(N)C2 |
| InChI | InChI=1S/C15H23NO4/c1-2-19-12-6-3-5-10-9-11(16)15(14(10)12)20-8-4-7-13(17)18/h3,5-6,11,13,15,17-18H,2,4,7-9,16H2,1H3 |
| InChIKey | RYYQMMDPISNQHO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|