C12H18N2O2 — CID 65244962
2-[(3-aminoazetidin-1-yl)methyl]-6-ethoxyphenol (PubChem CID 65244962) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-[(3-aminoazetidin-1-yl)methyl]-6-ethoxyphenol.
| Compound Name | 2-[(3-aminoazetidin-1-yl)methyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 65244962 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-[(3-aminoazetidin-1-yl)methyl]-6-ethoxyphenol |
| SMILES | CCOc1cccc(CN2CC(N)C2)c1O |
| InChI | InChI=1S/C12H18N2O2/c1-2-16-11-5-3-4-9(12(11)15)6-14-7-10(13)8-14/h3-5,10,15H,2,6-8,13H2,1H3 |
| InChIKey | BXWYABUZNCFWHQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|