C21H34N2O3 — CID 51907434
2-[[(3R)-4-cyclohexyl-3-(2-hydroxyethyl)piperazin-1-yl]methyl]-6-ethoxyphenol (PubChem CID 51907434) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-[[(3R)-4-cyclohexyl-3-(2-hydroxyethyl)piperazin-1-yl]methyl]-6-ethoxyphenol.
| Compound Name | 2-[[(3R)-4-cyclohexyl-3-(2-hydroxyethyl)piperazin-1-yl]methyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 51907434 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 2-[[(3R)-4-cyclohexyl-3-(2-hydroxyethyl)piperazin-1-yl]methyl]-6-ethoxyphenol |
| SMILES | CCOc1cccc(CN2CCN(C3CCCCC3)[C@H](CCO)C2)c1O |
| InChI | InChI=1S/C21H34N2O3/c1-2-26-20-10-6-7-17(21(20)25)15-22-12-13-23(19(16-22)11-14-24)18-8-4-3-5-9-18/h6-7,10,18-19,24-25H,2-5,8-9,11-16H2,1H3/t19-/m1/s1 |
| InChIKey | HWSNVCUOLGTTPD-LJQANCHMSA-N |
| XLogP | 2.99 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|