C23H32N2O4 — CID 45228799
2-ethoxy-6-[[3-(2-hydroxyethyl)-4-[(3-methoxyphenyl)methyl]piperazin-1-yl]methyl]phenol (PubChem CID 45228799) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-ethoxy-6-[[3-(2-hydroxyethyl)-4-[(3-methoxyphenyl)methyl]piperazin-1-yl]methyl]phenol.
| Compound Name | 2-ethoxy-6-[[3-(2-hydroxyethyl)-4-[(3-methoxyphenyl)methyl]piperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 45228799 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 2-ethoxy-6-[[3-(2-hydroxyethyl)-4-[(3-methoxyphenyl)methyl]piperazin-1-yl]methyl]phenol |
| SMILES | CCOc1cccc(CN2CCN(Cc3cccc(OC)c3)C(CCO)C2)c1O |
| InChI | InChI=1S/C23H32N2O4/c1-3-29-22-9-5-7-19(23(22)27)16-24-11-12-25(20(17-24)10-13-26)15-18-6-4-8-21(14-18)28-2/h4-9,14,20,26-27H,3,10-13,15-17H2,1-2H3 |
| InChIKey | SQRDJBNJUJWPJE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|