C22H31N3O3 — CID 45232523
2-ethoxy-6-[[3-(2-hydroxyethyl)-4-[(6-methyl-2-pyridinyl)methyl]piperazin-1-yl]methyl]phenol (PubChem CID 45232523) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-ethoxy-6-[[3-(2-hydroxyethyl)-4-[(6-methyl-2-pyridinyl)methyl]piperazin-1-yl]methyl]phenol.
| Compound Name | 2-ethoxy-6-[[3-(2-hydroxyethyl)-4-[(6-methyl-2-pyridinyl)methyl]piperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 45232523 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 2-ethoxy-6-[[3-(2-hydroxyethyl)-4-[(6-methyl-2-pyridinyl)methyl]piperazin-1-yl]methyl]phenol |
| SMILES | CCOc1cccc(CN2CCN(Cc3cccc(C)n3)C(CCO)C2)c1O |
| InChI | InChI=1S/C22H31N3O3/c1-3-28-21-9-5-7-18(22(21)27)14-24-11-12-25(20(16-24)10-13-26)15-19-8-4-6-17(2)23-19/h4-9,20,26-27H,3,10-16H2,1-2H3 |
| InChIKey | XUDDVNUVYXAABR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|