C19H29N5O — CID 51635125
2-[(2S)-1-[(6-methyl-2-pyridinyl)methyl]-4-(3-pyrazol-1-ylpropyl)piperazin-2-yl]ethanol (PubChem CID 51635125) has the molecular formula C19H29N5O and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-[(2S)-1-[(6-methyl-2-pyridinyl)methyl]-4-(3-pyrazol-1-ylpropyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-1-[(6-methyl-2-pyridinyl)methyl]-4-(3-pyrazol-1-ylpropyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 51635125 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 2-[(2S)-1-[(6-methyl-2-pyridinyl)methyl]-4-(3-pyrazol-1-ylpropyl)piperazin-2-yl]ethanol |
| SMILES | Cc1cccc(CN2CCN(CCCn3cccn3)C[C@@H]2CCO)n1 |
| InChI | InChI=1S/C19H29N5O/c1-17-5-2-6-18(21-17)15-23-13-12-22(16-19(23)7-14-25)9-4-11-24-10-3-8-20-24/h2-3,5-6,8,10,19,25H,4,7,9,11-16H2,1H3/t19-/m0/s1 |
| InChIKey | YIDXDIANQXOZNA-IBGZPJMESA-N |
| XLogP | 1.55 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |