C17H27NO4 — CID 166125690
3-[(2-amino-6-ethoxy-2,3-dihydro-1H-inden-1-yl)oxy]propanal;methoxyethane (PubChem CID 166125690) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-[(2-amino-6-ethoxy-2,3-dihydro-1H-inden-1-yl)oxy]propanal;methoxyethane.
| Compound Name | 3-[(2-amino-6-ethoxy-2,3-dihydro-1H-inden-1-yl)oxy]propanal;methoxyethane |
|---|---|
| PubChem CID | 166125690 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 3-[(2-amino-6-ethoxy-2,3-dihydro-1H-inden-1-yl)oxy]propanal;methoxyethane |
| SMILES | CCOC.CCOc1ccc2c(c1)C(OCCC=O)C(N)C2 |
| InChI | InChI=1S/C14H19NO3.C3H8O/c1-2-17-11-5-4-10-8-13(15)14(12(10)9-11)18-7-3-6-16;1-3-4-2/h4-6,9,13-14H,2-3,7-8,15H2,1H3;3H2,1-2H3 |
| InChIKey | TZDMZOVEZFFWHL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|