About ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate
ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate (PubChem CID 166125940) has the molecular formula C14H19NO4
and a molecular weight of 265.31 g/mol. Its IUPAC name is ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate |
| PubChem CID | 166125940 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate |
| SMILES | CCOC(=O)CCOC1c2cc(O)ccc2CC1N |
| InChI | InChI=1S/C14H19NO4/c1-2-18-13(17)5-6-19-14-11-8-10(16)4-3-9(11)7-12(14)15/h3-4,8,12,14,16H,2,5-7,15H2,1H3 |
| InChIKey | XSKRLUOBNHVFKP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate?
The IUPAC name of ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate (CID 166125940) is ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate.
What is the SMILES notation for ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate?
The canonical SMILES for ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate is CCOC(=O)CCOC1c2cc(O)ccc2CC1N.
What is the InChIKey of ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate?
The InChIKey is XSKRLUOBNHVFKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c1-2-18-13(17)5-6-19-14-11-8-10(16)4-3-9(11)7-12(14)15/h3-4,8,12,14,16H,2,5-7,15H2,1H3.
What are the key properties of ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate?
ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate has a molecular weight of 265.31 g/mol, XLogP of 1.29, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(2-amino-6-hydroxy-2,3-dihydro-1H-inden-1-yl)oxy]propanoate is sourced from PubChem (CID 166125940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).